C16H16Cl3NS — CID 81159693
N-[[3-chloro-4-(3,4-dichlorophenyl)sulfanylphenyl]methyl]propan-1-amine (PubChem CID 81159693) has the molecular formula C16H16Cl3NS and a molecular weight of 360.74 g/mol. Its IUPAC name is N-[[3-chloro-4-(3,4-dichlorophenyl)sulfanylphenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-chloro-4-(3,4-dichlorophenyl)sulfanylphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81159693 |
| Molecular Formula | C16H16Cl3NS |
| Molecular Weight | 360.74 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-[[3-chloro-4-(3,4-dichlorophenyl)sulfanylphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Sc2ccc(Cl)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl3NS/c1-2-7-20-10-11-3-6-16(15(19)8-11)21-12-4-5-13(17)14(18)9-12/h3-6,8-9,20H,2,7,10H2,1H3 |
| InChIKey | WRURDCRRXISXBN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|