C16H17BrClNS — CID 81159092
N-[[4-(4-bromophenyl)sulfanyl-3-chlorophenyl]methyl]propan-1-amine (PubChem CID 81159092) has the molecular formula C16H17BrClNS and a molecular weight of 370.74 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)sulfanyl-3-chlorophenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(4-bromophenyl)sulfanyl-3-chlorophenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81159092 |
| Molecular Formula | C16H17BrClNS |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[[4-(4-bromophenyl)sulfanyl-3-chlorophenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Sc2ccc(Br)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H17BrClNS/c1-2-9-19-11-12-3-8-16(15(18)10-12)20-14-6-4-13(17)5-7-14/h3-8,10,19H,2,9,11H2,1H3 |
| InChIKey | WTSPRRDCLRICFD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|