C15H16Cl2N2S — CID 80640608
N-[[6-(2,5-dichlorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine (PubChem CID 80640608) has the molecular formula C15H16Cl2N2S and a molecular weight of 327.28 g/mol. Its IUPAC name is N-[[6-(2,5-dichlorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(2,5-dichlorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80640608 |
| Molecular Formula | C15H16Cl2N2S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-[[6-(2,5-dichlorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Sc2cc(Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C15H16Cl2N2S/c1-2-7-18-9-11-3-6-15(19-10-11)20-14-8-12(16)4-5-13(14)17/h3-6,8,10,18H,2,7,9H2,1H3 |
| InChIKey | YDDBTJUIODUYJT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|