C12H16N4S3 — CID 115383866
N-[[6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-pyridinyl]methyl]propan-1-amine (PubChem CID 115383866) has the molecular formula C12H16N4S3 and a molecular weight of 312.49 g/mol. Its IUPAC name is N-[[6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115383866 |
| Molecular Formula | C12H16N4S3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-[[6-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Sc2nnc(SC)s2)nc1 |
| InChI | InChI=1S/C12H16N4S3/c1-3-6-13-7-9-4-5-10(14-8-9)18-12-16-15-11(17-2)19-12/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | XVWHHHDAEILRKM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|