C15H17FN2S — CID 80639944
N-[[6-(4-fluorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine (PubChem CID 80639944) has the molecular formula C15H17FN2S and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[[6-(4-fluorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(4-fluorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80639944 |
| Molecular Formula | C15H17FN2S |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-[[6-(4-fluorophenyl)sulfanyl-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Sc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C15H17FN2S/c1-2-9-17-10-12-3-8-15(18-11-12)19-14-6-4-13(16)5-7-14/h3-8,11,17H,2,9-10H2,1H3 |
| InChIKey | FMRPKQZKUIQAFU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|