C16H17Cl2NS — CID 114864012
N-[[4-chloro-2-(2-chlorophenyl)sulfanylphenyl]methyl]propan-1-amine (PubChem CID 114864012) has the molecular formula C16H17Cl2NS and a molecular weight of 326.29 g/mol. Its IUPAC name is N-[[4-chloro-2-(2-chlorophenyl)sulfanylphenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-chloro-2-(2-chlorophenyl)sulfanylphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114864012 |
| Molecular Formula | C16H17Cl2NS |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[[4-chloro-2-(2-chlorophenyl)sulfanylphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Cl)cc1Sc1ccccc1Cl |
| InChI | InChI=1S/C16H17Cl2NS/c1-2-9-19-11-12-7-8-13(17)10-16(12)20-15-6-4-3-5-14(15)18/h3-8,10,19H,2,9,11H2,1H3 |
| InChIKey | HTRMOGBBLWWLRW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|