C19H24Cl2N2S — CID 59066651
N-[[2-(2,4-dichlorophenyl)sulfanylphenyl]methyl]-N',N'-dimethylbutane-1,4-diamine (PubChem CID 59066651) has the molecular formula C19H24Cl2N2S and a molecular weight of 383.39 g/mol. Its IUPAC name is N-[[2-(2,4-dichlorophenyl)sulfanylphenyl]methyl]-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-[[2-(2,4-dichlorophenyl)sulfanylphenyl]methyl]-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 59066651 |
| Molecular Formula | C19H24Cl2N2S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | N-[[2-(2,4-dichlorophenyl)sulfanylphenyl]methyl]-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNCc1ccccc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H24Cl2N2S/c1-23(2)12-6-5-11-22-14-15-7-3-4-8-18(15)24-19-10-9-16(20)13-17(19)21/h3-4,7-10,13,22H,5-6,11-12,14H2,1-2H3 |
| InChIKey | NLVHPMSMYCEBOS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|