C20H25F3N2S — CID 59066637
N',N'-dimethyl-N-[[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]methyl]butane-1,4-diamine (PubChem CID 59066637) has the molecular formula C20H25F3N2S and a molecular weight of 382.50 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]methyl]butane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-[[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 59066637 |
| Molecular Formula | C20H25F3N2S |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N',N'-dimethyl-N-[[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]methyl]butane-1,4-diamine |
| SMILES | CN(C)CCCCNCc1ccccc1Sc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H25F3N2S/c1-25(2)13-6-5-12-24-15-16-8-3-4-11-19(16)26-18-10-7-9-17(14-18)20(21,22)23/h3-4,7-11,14,24H,5-6,12-13,15H2,1-2H3 |
| InChIKey | OBHLRPUEKBTBTD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|