C10H12F3NS — CID 170424534
N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfanylmethanamine (PubChem CID 170424534) has the molecular formula C10H12F3NS and a molecular weight of 235.27 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfanylmethanamine.
| Compound Name | N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 170424534 |
| Molecular Formula | C10H12F3NS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | N,N-dimethyl-1-[3-(trifluoromethyl)phenyl]sulfanylmethanamine |
| SMILES | CN(C)CSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3NS/c1-14(2)7-15-9-5-3-4-8(6-9)10(11,12)13/h3-6H,7H2,1-2H3 |
| InChIKey | PXEADOFEHYSDKT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|