C12H16F3NS2 — CID 66219357
2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine (PubChem CID 66219357) has the molecular formula C12H16F3NS2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine.
| Compound Name | 2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 66219357 |
| Molecular Formula | C12H16F3NS2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine |
| SMILES | CC(CN)SCCSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NS2/c1-9(8-16)17-5-6-18-11-4-2-3-10(7-11)12(13,14)15/h2-4,7,9H,5-6,8,16H2,1H3 |
| InChIKey | QIXHOIGCDPNEGL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|