C13H16F3NO2S — CID 62638705
2-[methyl-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]amino]propanoic acid (PubChem CID 62638705) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-[methyl-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 62638705 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[methyl-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CCSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2S/c1-9(12(18)19)17(2)6-7-20-11-5-3-4-10(8-11)13(14,15)16/h3-5,8-9H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | CGASLYPYIVVNRJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |