C13H18F3NS2 — CID 66225210
2-methyl-3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine (PubChem CID 66225210) has the molecular formula C13H18F3NS2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-methyl-3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine.
| Compound Name | 2-methyl-3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 66225210 |
| Molecular Formula | C13H18F3NS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-methyl-3-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]propan-1-amine |
| SMILES | CC(CN)CSCCSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NS2/c1-10(8-17)9-18-5-6-19-12-4-2-3-11(7-12)13(14,15)16/h2-4,7,10H,5-6,8-9,17H2,1H3 |
| InChIKey | DDTLXQXDSJWKDX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|