C15H10F3O2S- — CID 6947877
2-[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]acetate (PubChem CID 6947877) has the molecular formula C15H10F3O2S- and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]acetate.
| Compound Name | 2-[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 6947877 |
| Molecular Formula | C15H10F3O2S- |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-[2-[3-(trifluoromethyl)phenyl]sulfanylphenyl]acetate |
| SMILES | O=C([O-])Cc1ccccc1Sc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3O2S/c16-15(17,18)11-5-3-6-12(9-11)21-13-7-2-1-4-10(13)8-14(19)20/h1-7,9H,8H2,(H,19,20)/p-1 |
| InChIKey | OAHIVACTUGYMGU-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |