C15H9F3O2S — CID 142475492
S-(7-oxocyclohepta-1,3,5-trien-1-yl) 3-(trifluoromethyl)benzenecarbothioate (PubChem CID 142475492) has the molecular formula C15H9F3O2S and a molecular weight of 310.30 g/mol. Its IUPAC name is S-(7-oxocyclohepta-1,3,5-trien-1-yl) 3-(trifluoromethyl)benzenecarbothioate.
| Compound Name | S-(7-oxocyclohepta-1,3,5-trien-1-yl) 3-(trifluoromethyl)benzenecarbothioate |
|---|---|
| PubChem CID | 142475492 |
| Molecular Formula | C15H9F3O2S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | S-(7-oxocyclohepta-1,3,5-trien-1-yl) 3-(trifluoromethyl)benzenecarbothioate |
| SMILES | O=C(Sc1cccccc1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F3O2S/c16-15(17,18)11-6-4-5-10(9-11)14(20)21-13-8-3-1-2-7-12(13)19/h1-9H |
| InChIKey | FDIUQWYPQDTEGN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|