C68H36F12 — CID 102229847
3,9-dibenzhydrylidene-6,12-bis[bis[3-(trifluoromethyl)phenyl]methylidene]cyclododeca-1,4,7,10-tetrayne (PubChem CID 102229847) has the molecular formula C68H36F12 and a molecular weight of 1081.01 g/mol. Its IUPAC name is 3,9-dibenzhydrylidene-6,12-bis[bis[3-(trifluoromethyl)phenyl]methylidene]cyclododeca-1,4,7,10-tetrayne.
| Compound Name | 3,9-dibenzhydrylidene-6,12-bis[bis[3-(trifluoromethyl)phenyl]methylidene]cyclododeca-1,4,7,10-tetrayne |
|---|---|
| PubChem CID | 102229847 |
| Molecular Formula | C68H36F12 |
| Molecular Weight | 1081.01 g/mol |
| Exact Mass | 1080.26 |
| IUPAC Name | 3,9-dibenzhydrylidene-6,12-bis[bis[3-(trifluoromethyl)phenyl]methylidene]cyclododeca-1,4,7,10-tetrayne |
| SMILES | FC(F)(F)c1cccc(C(=C2C#CC(=C(c3ccccc3)c3ccccc3)C#CC(=C(c3cccc(C(F)(F)F)c3)c3cccc(C(F)(F)F)c3)C#CC(=C(c3ccccc3)c3ccccc3)C#C2)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C68H36F12/c69-65(70,71)57-29-13-25-53(41-57)63(54-26-14-30-58(42-54)66(72,73)74)51-37-33-49(61(45-17-5-1-6-18-45)46-19-7-2-8-20-46)34-38-52(40-36-50(35-39-51)62(47-21-9-3-10-22-47)48-23-11-4-12-24-48)64(55-27-15-31-59(43-55)67(75,76)77)56-28-16-32-60(44-56)68(78,79)80/h1-32,41-44H |
| InChIKey | BZCKCXYBESEOKU-UHFFFAOYSA-N |
| XLogP | 18.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.01 |
| LogP ≤ 5 | 18.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|