C18H13F3O2 — CID 91238764
5-phenyl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 91238764) has the molecular formula C18H13F3O2 and a molecular weight of 318.29 g/mol. Its IUPAC name is 5-phenyl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-phenyl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 91238764 |
| Molecular Formula | C18H13F3O2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-phenyl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=C(c1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3O2/c19-18(20,21)15-9-4-8-14(12-15)16(10-5-11-17(22)23)13-6-2-1-3-7-13/h1-12H,(H,22,23) |
| InChIKey | BQLJKERVGYJYAE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|