C23H19F6NOS — CID 25059376
(2E)-1-thiomorpholin-4-yl-5,5-bis[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one (PubChem CID 25059376) has the molecular formula C23H19F6NOS and a molecular weight of 471.47 g/mol. Its IUPAC name is (2E)-1-thiomorpholin-4-yl-5,5-bis[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one.
| Compound Name | (2E)-1-thiomorpholin-4-yl-5,5-bis[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 25059376 |
| Molecular Formula | C23H19F6NOS |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (2E)-1-thiomorpholin-4-yl-5,5-bis[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)N1CCSCC1 |
| InChI | InChI=1S/C23H19F6NOS/c24-22(25,26)18-6-1-4-16(14-18)20(17-5-2-7-19(15-17)23(27,28)29)8-3-9-21(31)30-10-12-32-13-11-30/h1-9,14-15H,10-13H2/b9-3+ |
| InChIKey | UBORJTTUYRFZPW-YCRREMRBSA-N |
| XLogP | 6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|