C29H37NOS — CID 25059632
(2E)-5,5-bis(4-tert-butylphenyl)-1-thiomorpholin-4-ylpenta-2,4-dien-1-one (PubChem CID 25059632) has the molecular formula C29H37NOS and a molecular weight of 447.69 g/mol. Its IUPAC name is (2E)-5,5-bis(4-tert-butylphenyl)-1-thiomorpholin-4-ylpenta-2,4-dien-1-one.
| Compound Name | (2E)-5,5-bis(4-tert-butylphenyl)-1-thiomorpholin-4-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 25059632 |
| Molecular Formula | C29H37NOS |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (2E)-5,5-bis(4-tert-butylphenyl)-1-thiomorpholin-4-ylpenta-2,4-dien-1-one |
| SMILES | CC(C)(C)c1ccc(C(=C/C=C/C(=O)N2CCSCC2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H37NOS/c1-28(2,3)24-14-10-22(11-15-24)26(23-12-16-25(17-13-23)29(4,5)6)8-7-9-27(31)30-18-20-32-21-19-30/h7-17H,18-21H2,1-6H3/b9-7+ |
| InChIKey | CVMBUWJBOIDYMS-VQHVLOKHSA-N |
| XLogP | 6.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|