C23H19F6NO3S — CID 91374846
1-thiomorpholin-4-yl-5,5-bis[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one (PubChem CID 91374846) has the molecular formula C23H19F6NO3S and a molecular weight of 503.46 g/mol. Its IUPAC name is 1-thiomorpholin-4-yl-5,5-bis[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one.
| Compound Name | 1-thiomorpholin-4-yl-5,5-bis[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 91374846 |
| Molecular Formula | C23H19F6NO3S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 1-thiomorpholin-4-yl-5,5-bis[4-(trifluoromethoxy)phenyl]penta-2,4-dien-1-one |
| SMILES | O=C(C=CC=C(c1ccc(OC(F)(F)F)cc1)c1ccc(OC(F)(F)F)cc1)N1CCSCC1 |
| InChI | InChI=1S/C23H19F6NO3S/c24-22(25,26)32-18-8-4-16(5-9-18)20(2-1-3-21(31)30-12-14-34-15-13-30)17-6-10-19(11-7-17)33-23(27,28)29/h1-11H,12-15H2 |
| InChIKey | IVNKUYKPJTVZRO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|