C21H17F5N2O3 — CID 46399266
(E)-1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 46399266) has the molecular formula C21H17F5N2O3 and a molecular weight of 440.37 g/mol. Its IUPAC name is (E)-1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46399266 |
| Molecular Formula | C21H17F5N2O3 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (E)-1-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-3-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)(F)F)cc1)N1CCN(C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H17F5N2O3/c22-17-7-4-15(13-18(17)23)20(30)28-11-9-27(10-12-28)19(29)8-3-14-1-5-16(6-2-14)31-21(24,25)26/h1-8,13H,9-12H2/b8-3+ |
| InChIKey | KNQKNGBHBPXLHV-FPYGCLRLSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|