C22H19F5N2O3 — CID 46399770
(E)-3-[4-(difluoromethoxy)phenyl]-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 46399770) has the molecular formula C22H19F5N2O3 and a molecular weight of 454.40 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46399770 |
| Molecular Formula | C22H19F5N2O3 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)N1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H19F5N2O3/c23-21(24)32-18-8-1-15(2-9-18)3-10-19(30)28-11-13-29(14-12-28)20(31)16-4-6-17(7-5-16)22(25,26)27/h1-10,21H,11-14H2/b10-3+ |
| InChIKey | DQEMLTHTCFAHKX-XCVCLJGOSA-N |
| XLogP | 4.30 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|