C22H21F5N2O2 — CID 19329623
(Z)-3-[4-(difluoromethoxy)phenyl]-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 19329623) has the molecular formula C22H21F5N2O2 and a molecular weight of 440.41 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19329623 |
| Molecular Formula | C22H21F5N2O2 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C\c1ccc(OC(F)F)cc1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H21F5N2O2/c23-21(24)31-19-7-4-16(5-8-19)6-9-20(30)29-12-10-28(11-13-29)15-17-2-1-3-18(14-17)22(25,26)27/h1-9,14,21H,10-13,15H2/b9-6- |
| InChIKey | XMKXNNRTJZQGSP-TWGQIWQCSA-N |
| XLogP | 4.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|