C24H27F3N2O — CID 19329525
(E)-3-(4-propan-2-ylphenyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 19329525) has the molecular formula C24H27F3N2O and a molecular weight of 416.49 g/mol. Its IUPAC name is (E)-3-(4-propan-2-ylphenyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-propan-2-ylphenyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19329525 |
| Molecular Formula | C24H27F3N2O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (E)-3-(4-propan-2-ylphenyl)-1-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CC(C)c1ccc(/C=C/C(=O)N2CCN(Cc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C24H27F3N2O/c1-18(2)21-9-6-19(7-10-21)8-11-23(30)29-14-12-28(13-15-29)17-20-4-3-5-22(16-20)24(25,26)27/h3-11,16,18H,12-15,17H2,1-2H3/b11-8+ |
| InChIKey | GEVGJBPERLSEPZ-DHZHZOJOSA-N |
| XLogP | 5.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|