C23H26Cl2N2O — CID 19295021
(E)-1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 19295021) has the molecular formula C23H26Cl2N2O and a molecular weight of 417.38 g/mol. Its IUPAC name is (E)-1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19295021 |
| Molecular Formula | C23H26Cl2N2O |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (E)-1-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | CC(C)c1ccc(/C=C/C(=O)N2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C23H26Cl2N2O/c1-17(2)20-7-3-18(4-8-20)6-10-23(28)27-13-11-26(12-14-27)16-19-5-9-21(24)22(25)15-19/h3-10,15,17H,11-14,16H2,1-2H3/b10-6+ |
| InChIKey | GGDCJLDAZLAZSZ-UXBLZVDNSA-N |
| XLogP | 5.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|