C18H27N2O+ — CID 2168516
(E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 2168516) has the molecular formula C18H27N2O+ and a molecular weight of 287.43 g/mol. Its IUPAC name is (E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2168516 |
| Molecular Formula | C18H27N2O+ |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | (E)-1-(4-ethylpiperazin-4-ium-1-yl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | CC[NH+]1CCN(C(=O)/C=C/c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C18H26N2O/c1-4-19-11-13-20(14-12-19)18(21)10-7-16-5-8-17(9-6-16)15(2)3/h5-10,15H,4,11-14H2,1-3H3/p+1/b10-7+ |
| InChIKey | BTYDXIFKMKSDTM-JXMROGBWSA-O |
| XLogP | 1.57 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|