C14H21N2O2+ — CID 4746082
1-(4-ethylpiperazin-4-ium-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one (PubChem CID 4746082) has the molecular formula C14H21N2O2+ and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-4-ium-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one.
| Compound Name | 1-(4-ethylpiperazin-4-ium-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4746082 |
| Molecular Formula | C14H21N2O2+ |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-(4-ethylpiperazin-4-ium-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one |
| SMILES | CC[NH+]1CCN(C(=O)C=Cc2ccc(C)o2)CC1 |
| InChI | InChI=1S/C14H20N2O2/c1-3-15-8-10-16(11-9-15)14(17)7-6-13-5-4-12(2)18-13/h4-7H,3,8-11H2,1-2H3/p+1 |
| InChIKey | JDDDFGSICKRJDW-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|