C14H19NO2 — CID 874177
(E)-1-(azepan-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one (PubChem CID 874177) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (E)-1-(azepan-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(azepan-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 874177 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (E)-1-(azepan-1-yl)-3-(5-methylfuran-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCCCCC2)o1 |
| InChI | InChI=1S/C14H19NO2/c1-12-6-7-13(17-12)8-9-14(16)15-10-4-2-3-5-11-15/h6-9H,2-5,10-11H2,1H3/b9-8+ |
| InChIKey | XSJWUXZZSKQSRS-CMDGGOBGSA-N |
| XLogP | 3.00 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|