C18H19ClN2O4S — CID 26757311
(E)-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one (PubChem CID 26757311) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is (E)-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26757311 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (E)-1-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(5-methylfuran-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3ccccc3Cl)CC2)o1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-14-6-7-15(25-14)8-9-18(22)20-10-12-21(13-11-20)26(23,24)17-5-3-2-4-16(17)19/h2-9H,10-13H2,1H3/b9-8+ |
| InChIKey | IAYLXDYRFQQJKF-CMDGGOBGSA-N |
| XLogP | 2.79 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|