C23H27BrN2O — CID 19331834
(E)-1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 19331834) has the molecular formula C23H27BrN2O and a molecular weight of 427.39 g/mol. Its IUPAC name is (E)-1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19331834 |
| Molecular Formula | C23H27BrN2O |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (E)-1-[4-[(2-bromophenyl)methyl]piperazin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | CC(C)c1ccc(/C=C/C(=O)N2CCN(Cc3ccccc3Br)CC2)cc1 |
| InChI | InChI=1S/C23H27BrN2O/c1-18(2)20-10-7-19(8-11-20)9-12-23(27)26-15-13-25(14-16-26)17-21-5-3-4-6-22(21)24/h3-12,18H,13-17H2,1-2H3/b12-9+ |
| InChIKey | QOYJLNPHUZAUNB-FMIVXFBMSA-N |
| XLogP | 4.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|