C23H31N3O — CID 90495032
(E)-1-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 90495032) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is (E)-1-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90495032 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (E)-1-[4-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(C)n(CC2CCN(C(=O)/C=C/c3ccc(C(C)C)cc3)CC2)n1 |
| InChI | InChI=1S/C23H31N3O/c1-17(2)22-8-5-20(6-9-22)7-10-23(27)25-13-11-21(12-14-25)16-26-19(4)15-18(3)24-26/h5-10,15,17,21H,11-14,16H2,1-4H3/b10-7+ |
| InChIKey | YBZLOJBECDVNRM-JXMROGBWSA-N |
| XLogP | 4.58 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|