C22H25BrN2O — CID 122434893
(E)-3-(4-bromophenyl)-1-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122434893) has the molecular formula C22H25BrN2O and a molecular weight of 413.36 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-1-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-bromophenyl)-1-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122434893 |
| Molecular Formula | C22H25BrN2O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (E)-3-(4-bromophenyl)-1-[4-[(3,4-dimethylphenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(CN2CCN(C(=O)/C=C/c3ccc(Br)cc3)CC2)cc1C |
| InChI | InChI=1S/C22H25BrN2O/c1-17-3-4-20(15-18(17)2)16-24-11-13-25(14-12-24)22(26)10-7-19-5-8-21(23)9-6-19/h3-10,15H,11-14,16H2,1-2H3/b10-7+ |
| InChIKey | WULZJWSZUNJYAR-JXMROGBWSA-N |
| XLogP | 4.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|