C23H26N2O3 — CID 31362301
(E)-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one (PubChem CID 31362301) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (E)-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 31362301 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (E)-1-[4-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)piperazin-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(/C=C/C(=O)N2CCN(Cc3ccc4c(c3)OCCO4)CC2)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-18-3-2-4-19(15-18)6-8-23(26)25-11-9-24(10-12-25)17-20-5-7-21-22(16-20)28-14-13-27-21/h2-8,15-16H,9-14,17H2,1H3/b8-6+ |
| InChIKey | COPXMKKEGMLENI-SOFGYWHQSA-N |
| XLogP | 3.12 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|