C20H27N3O3 — CID 97433144
(Z)-3-(3-methylphenyl)-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 97433144) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (Z)-3-(3-methylphenyl)-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (Z)-3-(3-methylphenyl)-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 97433144 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (Z)-3-(3-methylphenyl)-1-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1cccc(/C=C\C(=O)N2CCN(C(=O)CN3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-17-3-2-4-18(15-17)5-6-19(24)22-7-9-23(10-8-22)20(25)16-21-11-13-26-14-12-21/h2-6,15H,7-14,16H2,1H3/b6-5- |
| InChIKey | HKNRQJUNINWTGH-WAYWQWQTSA-N |
| XLogP | 1.01 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|