C25H26F3N3O2 — CID 24610507
1-[4-[(E)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one (PubChem CID 24610507) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 1-[4-[(E)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(E)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 24610507 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-[4-[(E)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-1-enyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C(/C=C/c1ccc(N2CCCC2=O)cc1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H26F3N3O2/c26-25(27,28)21-4-1-3-20(17-21)18-29-13-15-30(16-14-29)23(32)11-8-19-6-9-22(10-7-19)31-12-2-5-24(31)33/h1,3-4,6-11,17H,2,5,12-16,18H2/b11-8+ |
| InChIKey | NWKNVYVEUTZENP-DHZHZOJOSA-N |
| XLogP | 4.19 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|