C23H24F3N3O2 — CID 55432883
1-[3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyrrolidin-2-one (PubChem CID 55432883) has the molecular formula C23H24F3N3O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is 1-[3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55432883 |
| Molecular Formula | C23H24F3N3O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C(c1cccc(N2CCCC2=O)c1)N1CCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H24F3N3O2/c24-23(25,26)19-8-6-17(7-9-19)16-27-11-13-28(14-12-27)22(31)18-3-1-4-20(15-18)29-10-2-5-21(29)30/h1,3-4,6-9,15H,2,5,10-14,16H2 |
| InChIKey | BCDOREZKPTXMAZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |