C21H21F3N2O3 — CID 55760139
methyl 3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]benzoate (PubChem CID 55760139) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is methyl 3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]benzoate.
| Compound Name | methyl 3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 55760139 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | methyl 3-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)N2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H21F3N2O3/c1-29-20(28)17-4-2-3-16(13-17)19(27)26-11-9-25(10-12-26)14-15-5-7-18(8-6-15)21(22,23)24/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | HJEZTMYAKUNNLY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |