C22H21F5N2O2 — CID 4776214
1-[3-(difluoromethoxy)phenyl]-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 4776214) has the molecular formula C22H21F5N2O2 and a molecular weight of 440.41 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4776214 |
| Molecular Formula | C22H21F5N2O2 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=CN1CCN(Cc2cccc(C(F)(F)F)c2)CC1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C22H21F5N2O2/c23-21(24)31-19-6-2-4-17(14-19)20(30)7-8-28-9-11-29(12-10-28)15-16-3-1-5-18(13-16)22(25,26)27/h1-8,13-14,21H,9-12,15H2 |
| InChIKey | DBMCYOMSWJZYFP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|