C20H21F5N2O — CID 171701581
1-[[4-(difluoromethoxy)phenyl]methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171701581) has the molecular formula C20H21F5N2O and a molecular weight of 400.39 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171701581 |
| Molecular Formula | C20H21F5N2O |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)Oc1ccc(CN2CCN(Cc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H21F5N2O/c21-19(22)28-18-6-4-15(5-7-18)13-26-8-10-27(11-9-26)14-16-2-1-3-17(12-16)20(23,24)25/h1-7,12,19H,8-11,13-14H2 |
| InChIKey | ZQQCKABUIGWFSO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |