C21H17BrF4N2O2 — CID 46399492
(E)-3-(5-bromo-2-fluorophenyl)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 46399492) has the molecular formula C21H17BrF4N2O2 and a molecular weight of 485.28 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46399492 |
| Molecular Formula | C21H17BrF4N2O2 |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)N1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H17BrF4N2O2/c22-17-6-7-18(23)15(13-17)3-8-19(29)27-9-11-28(12-10-27)20(30)14-1-4-16(5-2-14)21(24,25)26/h1-8,13H,9-12H2/b8-3+ |
| InChIKey | GTPIEFYMOSOZTQ-FPYGCLRLSA-N |
| XLogP | 4.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|