C19H17BrClFN2O — CID 26365764
(E)-3-(5-bromo-2-fluorophenyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 26365764) has the molecular formula C19H17BrClFN2O and a molecular weight of 423.71 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26365764 |
| Molecular Formula | C19H17BrClFN2O |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-(3-chlorophenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H17BrClFN2O/c20-15-5-6-18(22)14(12-15)4-7-19(25)24-10-8-23(9-11-24)17-3-1-2-16(21)13-17/h1-7,12-13H,8-11H2/b7-4+ |
| InChIKey | VRQRGAXFBLLOIO-QPJJXVBHSA-N |
| XLogP | 4.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|