C19H16BrFN4OS — CID 56535574
(E)-3-(5-bromo-2-fluorophenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 56535574) has the molecular formula C19H16BrFN4OS and a molecular weight of 447.33 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56535574 |
| Molecular Formula | C19H16BrFN4OS |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)N1CCN(c2nc3cccnc3s2)CC1 |
| InChI | InChI=1S/C19H16BrFN4OS/c20-14-4-5-15(21)13(12-14)3-6-17(26)24-8-10-25(11-9-24)19-23-16-2-1-7-22-18(16)27-19/h1-7,12H,8-11H2/b6-3+ |
| InChIKey | ZIXOZEMFCXRNJN-ZZXKWVIFSA-N |
| XLogP | 3.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|