C21H21N5O2S — CID 56551464
(E)-N-[2-oxo-2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 56551464) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is (E)-N-[2-oxo-2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-oxo-2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 56551464 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (E)-N-[2-oxo-2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)N1CCN(c2nc3cccnc3s2)CC1 |
| InChI | InChI=1S/C21H21N5O2S/c27-18(9-8-16-5-2-1-3-6-16)23-15-19(28)25-11-13-26(14-12-25)21-24-17-7-4-10-22-20(17)29-21/h1-10H,11-15H2,(H,23,27)/b9-8+ |
| InChIKey | FTJCERPQPWPJLB-CMDGGOBGSA-N |
| XLogP | 2.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|