C18H24N4OS3 — CID 56551585
5-(dithiolan-3-yl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pentan-1-one (PubChem CID 56551585) has the molecular formula C18H24N4OS3 and a molecular weight of 408.62 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 56551585 |
| Molecular Formula | C18H24N4OS3 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCN(c2nc3cccnc3s2)CC1 |
| InChI | InChI=1S/C18H24N4OS3/c23-16(6-2-1-4-14-7-13-24-26-14)21-9-11-22(12-10-21)18-20-15-5-3-8-19-17(15)25-18/h3,5,8,14H,1-2,4,6-7,9-13H2 |
| InChIKey | CYTPZGRPVDJMAH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|