C17H25N3OS2 — CID 96556681
5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one (PubChem CID 96556681) has the molecular formula C17H25N3OS2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 96556681 |
| Molecular Formula | C17H25N3OS2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-1-one |
| SMILES | O=C(CCCC[C@@H]1CCSS1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H25N3OS2/c21-17(7-2-1-5-15-8-14-22-23-15)20-12-10-19(11-13-20)16-6-3-4-9-18-16/h3-4,6,9,15H,1-2,5,7-8,10-14H2/t15-/m1/s1 |
| InChIKey | CHFPMIRLZCQTTJ-OAHLLOKOSA-N |
| XLogP | 3.44 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|