C20H19ClN4OS — CID 56579427
(E)-3-(3-chloro-4-methylphenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 56579427) has the molecular formula C20H19ClN4OS and a molecular weight of 398.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-methylphenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4-methylphenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56579427 |
| Molecular Formula | C20H19ClN4OS |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (E)-3-(3-chloro-4-methylphenyl)-1-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCN(c3nc4cccnc4s3)CC2)cc1Cl |
| InChI | InChI=1S/C20H19ClN4OS/c1-14-4-5-15(13-16(14)21)6-7-18(26)24-9-11-25(12-10-24)20-23-17-3-2-8-22-19(17)27-20/h2-8,13H,9-12H2,1H3/b7-6+ |
| InChIKey | ZUBKIIUQMSWHIT-VOTSOKGWSA-N |
| XLogP | 4.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|