C14H16BrFN2O — CID 126782973
1-(3-aminopiperidin-1-yl)-3-(5-bromo-2-fluorophenyl)prop-2-en-1-one (PubChem CID 126782973) has the molecular formula C14H16BrFN2O and a molecular weight of 327.20 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-3-(5-bromo-2-fluorophenyl)prop-2-en-1-one.
| Compound Name | 1-(3-aminopiperidin-1-yl)-3-(5-bromo-2-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126782973 |
| Molecular Formula | C14H16BrFN2O |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-3-(5-bromo-2-fluorophenyl)prop-2-en-1-one |
| SMILES | NC1CCCN(C(=O)C=Cc2cc(Br)ccc2F)C1 |
| InChI | InChI=1S/C14H16BrFN2O/c15-11-4-5-13(16)10(8-11)3-6-14(19)18-7-1-2-12(17)9-18/h3-6,8,12H,1-2,7,9,17H2 |
| InChIKey | FILSKJJQGRZUDH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|