C14H17ClF2N2O — CID 126774517
1-(3-aminopiperidin-1-yl)-3-(2,6-difluorophenyl)prop-2-en-1-one;hydrochloride (PubChem CID 126774517) has the molecular formula C14H17ClF2N2O and a molecular weight of 302.75 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-3-(2,6-difluorophenyl)prop-2-en-1-one;hydrochloride.
| Compound Name | 1-(3-aminopiperidin-1-yl)-3-(2,6-difluorophenyl)prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 126774517 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-3-(2,6-difluorophenyl)prop-2-en-1-one;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)C=Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C14H16F2N2O.ClH/c15-12-4-1-5-13(16)11(12)6-7-14(19)18-8-2-3-10(17)9-18;/h1,4-7,10H,2-3,8-9,17H2;1H |
| InChIKey | QJILBGOHLWLENZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|