C23H19F6NO2 — CID 90849138
1-(3-hydroxypyrrolidin-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one (PubChem CID 90849138) has the molecular formula C23H19F6NO2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 1-(3-hydroxypyrrolidin-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one.
| Compound Name | 1-(3-hydroxypyrrolidin-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 90849138 |
| Molecular Formula | C23H19F6NO2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 1-(3-hydroxypyrrolidin-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
| SMILES | O=C(C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)N1CCC(O)C1 |
| InChI | InChI=1S/C23H19F6NO2/c24-22(25,26)17-8-4-15(5-9-17)20(16-6-10-18(11-7-16)23(27,28)29)2-1-3-21(32)30-13-12-19(31)14-30/h1-11,19,31H,12-14H2 |
| InChIKey | OSCPDHSYEORRHQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|