C18H16F3NO2 — CID 111560971
[(3R)-3-hydroxypyrrolidin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 111560971) has the molecular formula C18H16F3NO2 and a molecular weight of 335.32 g/mol. Its IUPAC name is [(3R)-3-hydroxypyrrolidin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | [(3R)-3-hydroxypyrrolidin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 111560971 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [(3R)-3-hydroxypyrrolidin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccccc1-c1ccc(C(F)(F)F)cc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)13-7-5-12(6-8-13)15-3-1-2-4-16(15)17(24)22-10-9-14(23)11-22/h1-8,14,23H,9-11H2/t14-/m1/s1 |
| InChIKey | JTGUWPSMOSBPFO-CQSZACIVSA-N |
| XLogP | 3.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |