C22H24F3N3O4S — CID 38457840
(4-morpholin-4-ylsulfonylpiperazin-1-yl)-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 38457840) has the molecular formula C22H24F3N3O4S and a molecular weight of 483.51 g/mol. Its IUPAC name is (4-morpholin-4-ylsulfonylpiperazin-1-yl)-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | (4-morpholin-4-ylsulfonylpiperazin-1-yl)-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 38457840 |
| Molecular Formula | C22H24F3N3O4S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (4-morpholin-4-ylsulfonylpiperazin-1-yl)-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccccc1-c1ccc(C(F)(F)F)cc1)N1CCN(S(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C22H24F3N3O4S/c23-22(24,25)18-7-5-17(6-8-18)19-3-1-2-4-20(19)21(29)26-9-11-27(12-10-26)33(30,31)28-13-15-32-16-14-28/h1-8H,9-16H2 |
| InChIKey | MNZAAULNWZKBGR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |